C27H27FN2O3S — CID 10116582
[1-[(2-fluorophenyl)methyl]-3-(1-methylpiperidin-4-yl)indol-5-yl] benzenesulfonate (PubChem CID 10116582) has the molecular formula C27H27FN2O3S and a molecular weight of 478.59 g/mol. Its IUPAC name is [1-[(2-fluorophenyl)methyl]-3-(1-methylpiperidin-4-yl)indol-5-yl] benzenesulfonate.
| Compound Name | [1-[(2-fluorophenyl)methyl]-3-(1-methylpiperidin-4-yl)indol-5-yl] benzenesulfonate |
|---|---|
| PubChem CID | 10116582 |
| Molecular Formula | C27H27FN2O3S |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | [1-[(2-fluorophenyl)methyl]-3-(1-methylpiperidin-4-yl)indol-5-yl] benzenesulfonate |
| SMILES | CN1CCC(c2cn(Cc3ccccc3F)c3ccc(OS(=O)(=O)c4ccccc4)cc23)CC1 |
| InChI | InChI=1S/C27H27FN2O3S/c1-29-15-13-20(14-16-29)25-19-30(18-21-7-5-6-10-26(21)28)27-12-11-22(17-24(25)27)33-34(31,32)23-8-3-2-4-9-23/h2-12,17,19-20H,13-16,18H2,1H3 |
| InChIKey | RCSARYZHFBLLNG-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|