About 2-hydroxyprop-2-enoic acid;[3-(1-methylpiperidin-4-yl)-1-methylsulfonylindol-5-yl] benzenesulfonate
2-hydroxyprop-2-enoic acid;[3-(1-methylpiperidin-4-yl)-1-methylsulfonylindol-5-yl] benzenesulfonate (PubChem CID 91003072) has the molecular formula C24H28N2O8S2
and a molecular weight of 536.63 g/mol. Its IUPAC name is 2-hydroxyprop-2-enoic acid;[3-(1-methylpiperidin-4-yl)-1-methylsulfonylindol-5-yl] benzenesulfonate.
Molecular Properties
| Compound Name | 2-hydroxyprop-2-enoic acid;[3-(1-methylpiperidin-4-yl)-1-methylsulfonylindol-5-yl] benzenesulfonate |
| PubChem CID | 91003072 |
| Molecular Formula | C24H28N2O8S2 |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | 2-hydroxyprop-2-enoic acid;[3-(1-methylpiperidin-4-yl)-1-methylsulfonylindol-5-yl] benzenesulfonate |
| SMILES | C=C(O)C(=O)O.CN1CCC(c2cn(S(C)(=O)=O)c3ccc(OS(=O)(=O)c4ccccc4)cc23)CC1 |
| InChI | InChI=1S/C21H24N2O5S2.C3H4O3/c1-22-12-10-16(11-13-22)20-15-23(29(2,24)25)21-9-8-17(14-19(20)21)28-30(26,27)18-6-4-3-5-7-18;1-2(4)3(5)6/h3-9,14-16H,10-13H2,1-2H3;4H,1H2,(H,5,6) |
| InChIKey | DGXVSBQXDVKVCG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 143.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyprop-2-enoic acid;[3-(1-methylpiperidin-4-yl)-1-methylsulfonylindol-5-yl] benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyprop-2-enoic acid;[3-(1-methylpiperidin-4-yl)-1-methylsulfonylindol-5-yl] benzenesulfonate?
The IUPAC name of 2-hydroxyprop-2-enoic acid;[3-(1-methylpiperidin-4-yl)-1-methylsulfonylindol-5-yl] benzenesulfonate (CID 91003072) is 2-hydroxyprop-2-enoic acid;[3-(1-methylpiperidin-4-yl)-1-methylsulfonylindol-5-yl] benzenesulfonate.
What is the SMILES notation for 2-hydroxyprop-2-enoic acid;[3-(1-methylpiperidin-4-yl)-1-methylsulfonylindol-5-yl] benzenesulfonate?
The canonical SMILES for 2-hydroxyprop-2-enoic acid;[3-(1-methylpiperidin-4-yl)-1-methylsulfonylindol-5-yl] benzenesulfonate is C=C(O)C(=O)O.CN1CCC(c2cn(S(C)(=O)=O)c3ccc(OS(=O)(=O)c4ccccc4)cc23)CC1.
What is the InChIKey of 2-hydroxyprop-2-enoic acid;[3-(1-methylpiperidin-4-yl)-1-methylsulfonylindol-5-yl] benzenesulfonate?
The InChIKey is DGXVSBQXDVKVCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N2O5S2.C3H4O3/c1-22-12-10-16(11-13-22)20-15-23(29(2,24)25)21-9-8-17(14-19(20)21)28-30(26,27)18-6-4-3-5-7-18;1-2(4)3(5)6/h3-9,14-16H,10-13H2,1-2H3;4H,1H2,(H,5,6).
What are the key properties of 2-hydroxyprop-2-enoic acid;[3-(1-methylpiperidin-4-yl)-1-methylsulfonylindol-5-yl] benzenesulfonate?
2-hydroxyprop-2-enoic acid;[3-(1-methylpiperidin-4-yl)-1-methylsulfonylindol-5-yl] benzenesulfonate has a molecular weight of 536.63 g/mol, XLogP of 3.17, 6 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyprop-2-enoic acid;[3-(1-methylpiperidin-4-yl)-1-methylsulfonylindol-5-yl] benzenesulfonate is sourced from PubChem (CID 91003072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).