C24H28N2O8S2 — CID 91003072
2-hydroxyprop-2-enoic acid;[3-(1-methylpiperidin-4-yl)-1-methylsulfonylindol-5-yl] benzenesulfonate (PubChem CID 91003072) has the molecular formula C24H28N2O8S2 and a molecular weight of 536.63 g/mol. Its IUPAC name is 2-hydroxyprop-2-enoic acid;[3-(1-methylpiperidin-4-yl)-1-methylsulfonylindol-5-yl] benzenesulfonate.
| Compound Name | 2-hydroxyprop-2-enoic acid;[3-(1-methylpiperidin-4-yl)-1-methylsulfonylindol-5-yl] benzenesulfonate |
|---|---|
| PubChem CID | 91003072 |
| Molecular Formula | C24H28N2O8S2 |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | 2-hydroxyprop-2-enoic acid;[3-(1-methylpiperidin-4-yl)-1-methylsulfonylindol-5-yl] benzenesulfonate |
| SMILES | C=C(O)C(=O)O.CN1CCC(c2cn(S(C)(=O)=O)c3ccc(OS(=O)(=O)c4ccccc4)cc23)CC1 |
| InChI | InChI=1S/C21H24N2O5S2.C3H4O3/c1-22-12-10-16(11-13-22)20-15-23(29(2,24)25)21-9-8-17(14-19(20)21)28-30(26,27)18-6-4-3-5-7-18;1-2(4)3(5)6/h3-9,14-16H,10-13H2,1-2H3;4H,1H2,(H,5,6) |
| InChIKey | DGXVSBQXDVKVCG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 143.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|