C22H22F3N3O2 — CID 91601953
[3-(1-methylpiperidin-4-yl)-1-(pyridin-2-ylmethyl)indol-5-yl] 2,2,2-trifluoroacetate (PubChem CID 91601953) has the molecular formula C22H22F3N3O2 and a molecular weight of 417.43 g/mol. Its IUPAC name is [3-(1-methylpiperidin-4-yl)-1-(pyridin-2-ylmethyl)indol-5-yl] 2,2,2-trifluoroacetate.
| Compound Name | [3-(1-methylpiperidin-4-yl)-1-(pyridin-2-ylmethyl)indol-5-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 91601953 |
| Molecular Formula | C22H22F3N3O2 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | [3-(1-methylpiperidin-4-yl)-1-(pyridin-2-ylmethyl)indol-5-yl] 2,2,2-trifluoroacetate |
| SMILES | CN1CCC(c2cn(Cc3ccccn3)c3ccc(OC(=O)C(F)(F)F)cc23)CC1 |
| InChI | InChI=1S/C22H22F3N3O2/c1-27-10-7-15(8-11-27)19-14-28(13-16-4-2-3-9-26-16)20-6-5-17(12-18(19)20)30-21(29)22(23,24)25/h2-6,9,12,14-15H,7-8,10-11,13H2,1H3 |
| InChIKey | RHJFLGGMYNJNKM-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|