C32H30N2O9S2 — CID 87828519
[3-(1-methylpiperidin-4-yl)-1-naphthalen-1-ylsulfonylindol-5-yl] benzenesulfonate;oxalic acid (PubChem CID 87828519) has the molecular formula C32H30N2O9S2 and a molecular weight of 650.73 g/mol. Its IUPAC name is [3-(1-methylpiperidin-4-yl)-1-naphthalen-1-ylsulfonylindol-5-yl] benzenesulfonate;oxalic acid.
| Compound Name | [3-(1-methylpiperidin-4-yl)-1-naphthalen-1-ylsulfonylindol-5-yl] benzenesulfonate;oxalic acid |
|---|---|
| PubChem CID | 87828519 |
| Molecular Formula | C32H30N2O9S2 |
| Molecular Weight | 650.73 g/mol |
| Exact Mass | 650.14 |
| IUPAC Name | [3-(1-methylpiperidin-4-yl)-1-naphthalen-1-ylsulfonylindol-5-yl] benzenesulfonate;oxalic acid |
| SMILES | CN1CCC(c2cn(S(=O)(=O)c3cccc4ccccc34)c3ccc(OS(=O)(=O)c4ccccc4)cc23)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C30H28N2O5S2.C2H2O4/c1-31-18-16-23(17-19-31)28-21-32(38(33,34)30-13-7-9-22-8-5-6-12-26(22)30)29-15-14-24(20-27(28)29)37-39(35,36)25-10-3-2-4-11-25;3-1(4)2(5)6/h2-15,20-21,23H,16-19H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | PRCWNROWRYKQEP-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 160.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.73 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|