C30H32N4O8 — CID 10188325
N-[[(5aR,6aS,7S,10aS)-9-carbamoyl-7-(dimethylamino)-4-ethyl-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]methyl]pyridine-3-carboxamide (PubChem CID 10188325) has the molecular formula C30H32N4O8 and a molecular weight of 576.61 g/mol. Its IUPAC name is N-[[(5aR,6aS,7S,10aS)-9-carbamoyl-7-(dimethylamino)-4-ethyl-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]methyl]pyridine-3-carboxamide.
| Compound Name | N-[[(5aR,6aS,7S,10aS)-9-carbamoyl-7-(dimethylamino)-4-ethyl-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 10188325 |
| Molecular Formula | C30H32N4O8 |
| Molecular Weight | 576.61 g/mol |
| Exact Mass | 576.22 |
| IUPAC Name | N-[[(5aR,6aS,7S,10aS)-9-carbamoyl-7-(dimethylamino)-4-ethyl-1,10a-dihydroxy-8,10,11,12-tetraoxo-5,5a,6,6a,7,11a-hexahydrotetracen-2-yl]methyl]pyridine-3-carboxamide |
| SMILES | CCc1cc(CNC(=O)c2cccnc2)c(O)c2c1C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C30H32N4O8/c1-4-13-8-16(12-33-29(41)14-6-5-7-32-11-14)23(35)20-17(13)9-15-10-18-22(34(2)3)25(37)21(28(31)40)27(39)30(18,42)26(38)19(15)24(20)36/h5-8,11,15,18-19,21-22,35,42H,4,9-10,12H2,1-3H3,(H2,31,40)(H,33,41)/t15-,18-,19?,21?,22-,30-/m0/s1 |
| InChIKey | UOEQFYQLKTZCHX-ZFQLTVPGSA-N |
| XLogP | -0.25 |
| TPSA | 197.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.61 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|