C28H30F5N3O3 — CID 10196496
2-(2,4-difluorophenyl)-2-[5-(2,3-dihydro-1H-inden-2-yl)-2-(2-methylpropyl)-3,6-dioxopiperazin-1-yl]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 10196496) has the molecular formula C28H30F5N3O3 and a molecular weight of 551.56 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-2-[5-(2,3-dihydro-1H-inden-2-yl)-2-(2-methylpropyl)-3,6-dioxopiperazin-1-yl]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-(2,4-difluorophenyl)-2-[5-(2,3-dihydro-1H-inden-2-yl)-2-(2-methylpropyl)-3,6-dioxopiperazin-1-yl]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 10196496 |
| Molecular Formula | C28H30F5N3O3 |
| Molecular Weight | 551.56 g/mol |
| Exact Mass | 551.22 |
| IUPAC Name | 2-(2,4-difluorophenyl)-2-[5-(2,3-dihydro-1H-inden-2-yl)-2-(2-methylpropyl)-3,6-dioxopiperazin-1-yl]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | CC(C)CC1C(=O)NC(C2Cc3ccccc3C2)C(=O)N1C(C(=O)N(C)CC(F)(F)F)c1ccc(F)cc1F |
| InChI | InChI=1S/C28H30F5N3O3/c1-15(2)10-22-25(37)34-23(18-11-16-6-4-5-7-17(16)12-18)26(38)36(22)24(20-9-8-19(29)13-21(20)30)27(39)35(3)14-28(31,32)33/h4-9,13,15,18,22-24H,10-12,14H2,1-3H3,(H,34,37) |
| InChIKey | ZTSNZKRKRDMIBG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.56 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |