C29H35F2N3O5 — CID 142980220
2-(2,4-difluorophenyl)-2-[(2R,5R)-5-(2,3-dihydro-1H-inden-2-yl)-2-(2-methylpropyl)-3,6-dioxopiperazin-1-yl]-N-(2,2-dimethoxyethyl)acetamide (PubChem CID 142980220) has the molecular formula C29H35F2N3O5 and a molecular weight of 543.61 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-2-[(2R,5R)-5-(2,3-dihydro-1H-inden-2-yl)-2-(2-methylpropyl)-3,6-dioxopiperazin-1-yl]-N-(2,2-dimethoxyethyl)acetamide.
| Compound Name | 2-(2,4-difluorophenyl)-2-[(2R,5R)-5-(2,3-dihydro-1H-inden-2-yl)-2-(2-methylpropyl)-3,6-dioxopiperazin-1-yl]-N-(2,2-dimethoxyethyl)acetamide |
|---|---|
| PubChem CID | 142980220 |
| Molecular Formula | C29H35F2N3O5 |
| Molecular Weight | 543.61 g/mol |
| Exact Mass | 543.25 |
| IUPAC Name | 2-(2,4-difluorophenyl)-2-[(2R,5R)-5-(2,3-dihydro-1H-inden-2-yl)-2-(2-methylpropyl)-3,6-dioxopiperazin-1-yl]-N-(2,2-dimethoxyethyl)acetamide |
| SMILES | COC(CNC(=O)C(c1ccc(F)cc1F)N1C(=O)[C@@H](C2Cc3ccccc3C2)NC(=O)[C@H]1CC(C)C)OC |
| InChI | InChI=1S/C29H35F2N3O5/c1-16(2)11-23-27(35)33-25(19-12-17-7-5-6-8-18(17)13-19)29(37)34(23)26(21-10-9-20(30)14-22(21)31)28(36)32-15-24(38-3)39-4/h5-10,14,16,19,23-26H,11-13,15H2,1-4H3,(H,32,36)(H,33,35)/t23-,25-,26?/m1/s1 |
| InChIKey | MWQSNMSCUPHKJX-VVTDDVKJSA-N |
| XLogP | 2.90 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.61 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|