C38H37F2N3O4 — CID 44532863
(2R)-2-(2,4-difluorophenyl)-2-[(2S,5R)-5-(2,3-dihydro-1H-inden-2-yl)-2-(2-methylpropyl)-3,6-dioxopiperazin-1-yl]-N-(2-phenylmethoxyphenyl)acetamide (PubChem CID 44532863) has the molecular formula C38H37F2N3O4 and a molecular weight of 637.73 g/mol. Its IUPAC name is (2R)-2-(2,4-difluorophenyl)-2-[(2S,5R)-5-(2,3-dihydro-1H-inden-2-yl)-2-(2-methylpropyl)-3,6-dioxopiperazin-1-yl]-N-(2-phenylmethoxyphenyl)acetamide.
| Compound Name | (2R)-2-(2,4-difluorophenyl)-2-[(2S,5R)-5-(2,3-dihydro-1H-inden-2-yl)-2-(2-methylpropyl)-3,6-dioxopiperazin-1-yl]-N-(2-phenylmethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 44532863 |
| Molecular Formula | C38H37F2N3O4 |
| Molecular Weight | 637.73 g/mol |
| Exact Mass | 637.28 |
| IUPAC Name | (2R)-2-(2,4-difluorophenyl)-2-[(2S,5R)-5-(2,3-dihydro-1H-inden-2-yl)-2-(2-methylpropyl)-3,6-dioxopiperazin-1-yl]-N-(2-phenylmethoxyphenyl)acetamide |
| SMILES | CC(C)C[C@H]1C(=O)N[C@H](C2Cc3ccccc3C2)C(=O)N1[C@@H](C(=O)Nc1ccccc1OCc1ccccc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C38H37F2N3O4/c1-23(2)18-32-36(44)42-34(27-19-25-12-6-7-13-26(25)20-27)38(46)43(32)35(29-17-16-28(39)21-30(29)40)37(45)41-31-14-8-9-15-33(31)47-22-24-10-4-3-5-11-24/h3-17,21,23,27,32,34-35H,18-20,22H2,1-2H3,(H,41,45)(H,42,44)/t32-,34+,35+/m0/s1 |
| InChIKey | OQWPMNMCYFRXJY-RRKBCBNCSA-N |
| XLogP | 6.38 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.73 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |