C18H17NO7S — CID 102002487
prop-2-enyl (5S,6S)-6-[1-(3,4-dihydroxybenzoyl)oxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 102002487) has the molecular formula C18H17NO7S and a molecular weight of 391.40 g/mol. Its IUPAC name is prop-2-enyl (5S,6S)-6-[1-(3,4-dihydroxybenzoyl)oxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | prop-2-enyl (5S,6S)-6-[1-(3,4-dihydroxybenzoyl)oxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 102002487 |
| Molecular Formula | C18H17NO7S |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | prop-2-enyl (5S,6S)-6-[1-(3,4-dihydroxybenzoyl)oxyethyl]-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | C=CCOC(=O)C1=CS[C@H]2[C@@H](C(C)OC(=O)c3ccc(O)c(O)c3)C(=O)N12 |
| InChI | InChI=1S/C18H17NO7S/c1-3-6-25-18(24)11-8-27-16-14(15(22)19(11)16)9(2)26-17(23)10-4-5-12(20)13(21)7-10/h3-5,7-9,14,16,20-21H,1,6H2,2H3/t9?,14-,16-/m0/s1 |
| InChIKey | YZAFYBGEHBXYPA-NTFNSIDBSA-N |
| XLogP | 1.75 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|