C25H47NO8 — CID 102004434
2-[2-[(3R,4R,5S,7S,16S)-17-amino-4,16-dihydroxy-3,7-dimethylheptadecan-5-yl]oxy-2-oxoethyl]butanedioic acid (PubChem CID 102004434) has the molecular formula C25H47NO8 and a molecular weight of 489.65 g/mol. Its IUPAC name is 2-[2-[(3R,4R,5S,7S,16S)-17-amino-4,16-dihydroxy-3,7-dimethylheptadecan-5-yl]oxy-2-oxoethyl]butanedioic acid.
| Compound Name | 2-[2-[(3R,4R,5S,7S,16S)-17-amino-4,16-dihydroxy-3,7-dimethylheptadecan-5-yl]oxy-2-oxoethyl]butanedioic acid |
|---|---|
| PubChem CID | 102004434 |
| Molecular Formula | C25H47NO8 |
| Molecular Weight | 489.65 g/mol |
| Exact Mass | 489.33 |
| IUPAC Name | 2-[2-[(3R,4R,5S,7S,16S)-17-amino-4,16-dihydroxy-3,7-dimethylheptadecan-5-yl]oxy-2-oxoethyl]butanedioic acid |
| SMILES | CC[C@@H](C)[C@@H](O)[C@H](C[C@@H](C)CCCCCCCC[C@H](O)CN)OC(=O)CC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C25H47NO8/c1-4-18(3)24(31)21(34-23(30)15-19(25(32)33)14-22(28)29)13-17(2)11-9-7-5-6-8-10-12-20(27)16-26/h17-21,24,27,31H,4-16,26H2,1-3H3,(H,28,29)(H,32,33)/t17-,18+,19?,20-,21-,24+/m0/s1 |
| InChIKey | YZFDWMLFJPNPJS-YAUBIBOYSA-N |
| XLogP | 3.34 |
| TPSA | 167.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.65 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|