C26H49NO8 — CID 122227141
2-(18-amino-15,17-dihydroxy-4,8-dimethylnonadecan-6-yl)oxycarbonylbutanedioic acid (PubChem CID 122227141) has the molecular formula C26H49NO8 and a molecular weight of 503.68 g/mol. Its IUPAC name is 2-(18-amino-15,17-dihydroxy-4,8-dimethylnonadecan-6-yl)oxycarbonylbutanedioic acid.
| Compound Name | 2-(18-amino-15,17-dihydroxy-4,8-dimethylnonadecan-6-yl)oxycarbonylbutanedioic acid |
|---|---|
| PubChem CID | 122227141 |
| Molecular Formula | C26H49NO8 |
| Molecular Weight | 503.68 g/mol |
| Exact Mass | 503.35 |
| IUPAC Name | 2-(18-amino-15,17-dihydroxy-4,8-dimethylnonadecan-6-yl)oxycarbonylbutanedioic acid |
| SMILES | CCCC(C)CC(CC(C)CCCCCCC(O)CC(O)C(C)N)OC(=O)C(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C26H49NO8/c1-5-10-17(2)13-21(35-26(34)22(25(32)33)16-24(30)31)14-18(3)11-8-6-7-9-12-20(28)15-23(29)19(4)27/h17-23,28-29H,5-16,27H2,1-4H3,(H,30,31)(H,32,33) |
| InChIKey | INSBNZKWZLMJQU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 167.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.68 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|