C28H53NO11 — CID 118625913
16-amino-4,8,13,15-tetrahydroxy-4-(1-hydroxy-2-methylhexyl)-6-methylheptadecane-1,2,3-tricarboxylic acid (PubChem CID 118625913) has the molecular formula C28H53NO11 and a molecular weight of 579.73 g/mol. Its IUPAC name is 16-amino-4,8,13,15-tetrahydroxy-4-(1-hydroxy-2-methylhexyl)-6-methylheptadecane-1,2,3-tricarboxylic acid.
| Compound Name | 16-amino-4,8,13,15-tetrahydroxy-4-(1-hydroxy-2-methylhexyl)-6-methylheptadecane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 118625913 |
| Molecular Formula | C28H53NO11 |
| Molecular Weight | 579.73 g/mol |
| Exact Mass | 579.36 |
| IUPAC Name | 16-amino-4,8,13,15-tetrahydroxy-4-(1-hydroxy-2-methylhexyl)-6-methylheptadecane-1,2,3-tricarboxylic acid |
| SMILES | CCCCC(C)C(O)C(O)(CC(C)CC(O)CCCCC(O)CC(O)C(C)N)C(C(=O)O)C(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C28H53NO11/c1-5-6-9-17(3)25(35)28(40,24(27(38)39)21(26(36)37)14-23(33)34)15-16(2)12-19(30)10-7-8-11-20(31)13-22(32)18(4)29/h16-22,24-25,30-32,35,40H,5-15,29H2,1-4H3,(H,33,34)(H,36,37)(H,38,39) |
| InChIKey | DZUOKSQTBDRYRG-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 239.07 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.73 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|