C25H47NO10 — CID 162967095
(2R)-2-[2-[(3S,4S,5S,7R,13S,14R,16S)-17-amino-4,13,14,16-tetrahydroxy-3,7-dimethylheptadecan-5-yl]oxy-2-oxoethyl]butanedioic acid (PubChem CID 162967095) has the molecular formula C25H47NO10 and a molecular weight of 521.65 g/mol. Its IUPAC name is (2R)-2-[2-[(3S,4S,5S,7R,13S,14R,16S)-17-amino-4,13,14,16-tetrahydroxy-3,7-dimethylheptadecan-5-yl]oxy-2-oxoethyl]butanedioic acid.
| Compound Name | (2R)-2-[2-[(3S,4S,5S,7R,13S,14R,16S)-17-amino-4,13,14,16-tetrahydroxy-3,7-dimethylheptadecan-5-yl]oxy-2-oxoethyl]butanedioic acid |
|---|---|
| PubChem CID | 162967095 |
| Molecular Formula | C25H47NO10 |
| Molecular Weight | 521.65 g/mol |
| Exact Mass | 521.32 |
| IUPAC Name | (2R)-2-[2-[(3S,4S,5S,7R,13S,14R,16S)-17-amino-4,13,14,16-tetrahydroxy-3,7-dimethylheptadecan-5-yl]oxy-2-oxoethyl]butanedioic acid |
| SMILES | CC[C@H](C)[C@H](O)[C@H](C[C@H](C)CCCCC[C@H](O)[C@H](O)C[C@H](O)CN)OC(=O)C[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C25H47NO10/c1-4-16(3)24(33)21(36-23(32)12-17(25(34)35)11-22(30)31)10-15(2)8-6-5-7-9-19(28)20(29)13-18(27)14-26/h15-21,24,27-29,33H,4-14,26H2,1-3H3,(H,30,31)(H,34,35)/t15-,16+,17-,18+,19+,20-,21+,24+/m1/s1 |
| InChIKey | YKGILJZVMMTMQS-IHNRHKOVSA-N |
| XLogP | 1.28 |
| TPSA | 207.84 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.65 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|