C39H64NO16+ — CID 163166641
2-[2-[6-(3,4-dicarboxybutanoyloxy)-11,16,18-trihydroxy-19-(5-hydroxy-1,2-dihydropyridin-1-ium-1-yl)-5,9-dimethylicosan-7-yl]oxy-2-oxoethyl]butanedioic acid (PubChem CID 163166641) has the molecular formula C39H64NO16+ and a molecular weight of 802.93 g/mol. Its IUPAC name is 2-[2-[6-(3,4-dicarboxybutanoyloxy)-11,16,18-trihydroxy-19-(5-hydroxy-1,2-dihydropyridin-1-ium-1-yl)-5,9-dimethylicosan-7-yl]oxy-2-oxoethyl]butanedioic acid.
| Compound Name | 2-[2-[6-(3,4-dicarboxybutanoyloxy)-11,16,18-trihydroxy-19-(5-hydroxy-1,2-dihydropyridin-1-ium-1-yl)-5,9-dimethylicosan-7-yl]oxy-2-oxoethyl]butanedioic acid |
|---|---|
| PubChem CID | 163166641 |
| Molecular Formula | C39H64NO16+ |
| Molecular Weight | 802.93 g/mol |
| Exact Mass | 802.42 |
| IUPAC Name | 2-[2-[6-(3,4-dicarboxybutanoyloxy)-11,16,18-trihydroxy-19-(5-hydroxy-1,2-dihydropyridin-1-ium-1-yl)-5,9-dimethylicosan-7-yl]oxy-2-oxoethyl]butanedioic acid |
| SMILES | CCCCC(C)C(OC(=O)CC(CC(=O)O)C(=O)O)C(CC(C)CC(O)CCCCC(O)CC(O)C(C)[NH+]1C=C(O)C=CC1)OC(=O)CC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C39H63NO16/c1-5-6-10-24(3)37(56-36(50)20-27(39(53)54)18-34(47)48)32(55-35(49)19-26(38(51)52)17-33(45)46)16-23(2)15-28(41)11-7-8-12-29(42)21-31(44)25(4)40-14-9-13-30(43)22-40/h9,13,22-29,31-32,37,41-44H,5-8,10-12,14-21H2,1-4H3,(H,45,46)(H,47,48)(H,51,52)(H,53,54)/p+1 |
| InChIKey | SZIZJCVVPHKJBO-UHFFFAOYSA-O |
| XLogP | 2.46 |
| TPSA | 287.16 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.93 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|