About N'-[7-chloro-3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]-4-methylbenzohydrazide
N'-[7-chloro-3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]-4-methylbenzohydrazide (PubChem CID 102011257) has the molecular formula C21H19ClN6O
and a molecular weight of 406.88 g/mol. Its IUPAC name is N'-[7-chloro-3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]-4-methylbenzohydrazide.
Molecular Properties
| Compound Name | N'-[7-chloro-3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]-4-methylbenzohydrazide |
| PubChem CID | 102011257 |
| Molecular Formula | C21H19ClN6O |
| Molecular Weight | 406.88 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | N'-[7-chloro-3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]-4-methylbenzohydrazide |
| SMILES | Cc1ccc(C(=O)NNc2nc3cc(Cl)ccc3nc2-n2nc(C)cc2C)cc1 |
| InChI | InChI=1S/C21H19ClN6O/c1-12-4-6-15(7-5-12)21(29)26-25-19-20(28-14(3)10-13(2)27-28)24-17-9-8-16(22)11-18(17)23-19/h4-11H,1-3H3,(H,23,25)(H,26,29) |
| InChIKey | ZEWNRZMKCYTTSI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.88 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-[7-chloro-3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]-4-methylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[7-chloro-3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]-4-methylbenzohydrazide?
The IUPAC name of N'-[7-chloro-3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]-4-methylbenzohydrazide (CID 102011257) is N'-[7-chloro-3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]-4-methylbenzohydrazide.
What is the SMILES notation for N'-[7-chloro-3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]-4-methylbenzohydrazide?
The canonical SMILES for N'-[7-chloro-3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]-4-methylbenzohydrazide is Cc1ccc(C(=O)NNc2nc3cc(Cl)ccc3nc2-n2nc(C)cc2C)cc1.
What is the InChIKey of N'-[7-chloro-3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]-4-methylbenzohydrazide?
The InChIKey is ZEWNRZMKCYTTSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19ClN6O/c1-12-4-6-15(7-5-12)21(29)26-25-19-20(28-14(3)10-13(2)27-28)24-17-9-8-16(22)11-18(17)23-19/h4-11H,1-3H3,(H,23,25)(H,26,29).
What are the key properties of N'-[7-chloro-3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]-4-methylbenzohydrazide?
N'-[7-chloro-3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]-4-methylbenzohydrazide has a molecular weight of 406.88 g/mol, XLogP of 4.15, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[7-chloro-3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]-4-methylbenzohydrazide is sourced from PubChem (CID 102011257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).