C21H19ClN6O — CID 102011257
N'-[7-chloro-3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]-4-methylbenzohydrazide (PubChem CID 102011257) has the molecular formula C21H19ClN6O and a molecular weight of 406.88 g/mol. Its IUPAC name is N'-[7-chloro-3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]-4-methylbenzohydrazide.
| Compound Name | N'-[7-chloro-3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]-4-methylbenzohydrazide |
|---|---|
| PubChem CID | 102011257 |
| Molecular Formula | C21H19ClN6O |
| Molecular Weight | 406.88 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | N'-[7-chloro-3-(3,5-dimethylpyrazol-1-yl)quinoxalin-2-yl]-4-methylbenzohydrazide |
| SMILES | Cc1ccc(C(=O)NNc2nc3cc(Cl)ccc3nc2-n2nc(C)cc2C)cc1 |
| InChI | InChI=1S/C21H19ClN6O/c1-12-4-6-15(7-5-12)21(29)26-25-19-20(28-14(3)10-13(2)27-28)24-17-9-8-16(22)11-18(17)23-19/h4-11H,1-3H3,(H,23,25)(H,26,29) |
| InChIKey | ZEWNRZMKCYTTSI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.88 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|