C6H13N3O2 — CID 102012729
(Z)-N'-methyl-1-nitro-N-propylethene-1,2-diamine (PubChem CID 102012729) has the molecular formula C6H13N3O2 and a molecular weight of 159.19 g/mol. Its IUPAC name is (Z)-N'-methyl-1-nitro-N-propylethene-1,2-diamine.
| Compound Name | (Z)-N'-methyl-1-nitro-N-propylethene-1,2-diamine |
|---|---|
| PubChem CID | 102012729 |
| Molecular Formula | C6H13N3O2 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | (Z)-N'-methyl-1-nitro-N-propylethene-1,2-diamine |
| SMILES | CCCN/C(=C/NC)[N+](=O)[O-] |
| InChI | InChI=1S/C6H13N3O2/c1-3-4-8-6(5-7-2)9(10)11/h5,7-8H,3-4H2,1-2H3/b6-5- |
| InChIKey | NVEUWWITRRRKQY-WAYWQWQTSA-N |
| XLogP | 0.28 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|