C8H15O10P — CID 102014647
(2R,4R,6S)-2,4-dihydroxy-6-[(1R)-1-hydroxy-2-phosphonooxyethyl]oxane-2-carboxylic acid (PubChem CID 102014647) has the molecular formula C8H15O10P and a molecular weight of 302.17 g/mol. Its IUPAC name is (2R,4R,6S)-2,4-dihydroxy-6-[(1R)-1-hydroxy-2-phosphonooxyethyl]oxane-2-carboxylic acid.
| Compound Name | (2R,4R,6S)-2,4-dihydroxy-6-[(1R)-1-hydroxy-2-phosphonooxyethyl]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 102014647 |
| Molecular Formula | C8H15O10P |
| Molecular Weight | 302.17 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | (2R,4R,6S)-2,4-dihydroxy-6-[(1R)-1-hydroxy-2-phosphonooxyethyl]oxane-2-carboxylic acid |
| SMILES | O=C(O)[C@@]1(O)C[C@H](O)C[C@@H]([C@H](O)COP(=O)(O)O)O1 |
| InChI | InChI=1S/C8H15O10P/c9-4-1-6(5(10)3-17-19(14,15)16)18-8(13,2-4)7(11)12/h4-6,9-10,13H,1-3H2,(H,11,12)(H2,14,15,16)/t4-,5-,6+,8-/m1/s1 |
| InChIKey | AIPSXSAMWIQYBR-MNCSTQPFSA-N |
| XLogP | -2.23 |
| TPSA | 173.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.17 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|