C6H9O9P-2 — CID 135070307
[(2R,3R)-5-carboxy-3,5-dihydroxyoxolan-2-yl]methyl phosphate (PubChem CID 135070307) has the molecular formula C6H9O9P-2 and a molecular weight of 256.10 g/mol. Its IUPAC name is [(2R,3R)-5-carboxy-3,5-dihydroxyoxolan-2-yl]methyl phosphate.
| Compound Name | [(2R,3R)-5-carboxy-3,5-dihydroxyoxolan-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 135070307 |
| Molecular Formula | C6H9O9P-2 |
| Molecular Weight | 256.10 g/mol |
| Exact Mass | 256.00 |
| IUPAC Name | [(2R,3R)-5-carboxy-3,5-dihydroxyoxolan-2-yl]methyl phosphate |
| SMILES | O=C(O)C1(O)C[C@@H](O)[C@@H](COP(=O)([O-])[O-])O1 |
| InChI | InChI=1S/C6H11O9P/c7-3-1-6(10,5(8)9)15-4(3)2-14-16(11,12)13/h3-4,7,10H,1-2H2,(H,8,9)(H2,11,12,13)/p-2/t3-,4-,6?/m1/s1 |
| InChIKey | VBVGMWXQCZHIPM-GPZYNHNGSA-L |
| XLogP | -3.25 |
| TPSA | 159.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.10 |
| LogP ≤ 5 | -3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|