C7H13O10P — CID 14380869
2,4,5-trihydroxy-6-(phosphonooxymethyl)oxane-2-carboxylic acid (PubChem CID 14380869) has the molecular formula C7H13O10P and a molecular weight of 288.15 g/mol. Its IUPAC name is 2,4,5-trihydroxy-6-(phosphonooxymethyl)oxane-2-carboxylic acid.
| Compound Name | 2,4,5-trihydroxy-6-(phosphonooxymethyl)oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 14380869 |
| Molecular Formula | C7H13O10P |
| Molecular Weight | 288.15 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | 2,4,5-trihydroxy-6-(phosphonooxymethyl)oxane-2-carboxylic acid |
| SMILES | O=C(O)C1(O)CC(O)C(O)C(COP(=O)(O)O)O1 |
| InChI | InChI=1S/C7H13O10P/c8-3-1-7(12,6(10)11)17-4(5(3)9)2-16-18(13,14)15/h3-5,8-9,12H,1-2H2,(H,10,11)(H2,13,14,15) |
| InChIKey | QOYBDYMPWLOFKG-UHFFFAOYSA-N |
| XLogP | -2.62 |
| TPSA | 173.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.15 |
| LogP ≤ 5 | -2.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|