C7H16NO8P — CID 140558629
[(2R,3S,4R,5R,6R)-5-amino-3,4,6-trihydroxy-6-methyloxan-2-yl]methyl dihydrogen phosphate (PubChem CID 140558629) has the molecular formula C7H16NO8P and a molecular weight of 273.18 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-5-amino-3,4,6-trihydroxy-6-methyloxan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R,6R)-5-amino-3,4,6-trihydroxy-6-methyloxan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 140558629 |
| Molecular Formula | C7H16NO8P |
| Molecular Weight | 273.18 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-5-amino-3,4,6-trihydroxy-6-methyloxan-2-yl]methyl dihydrogen phosphate |
| SMILES | C[C@@]1(O)O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]1N |
| InChI | InChI=1S/C7H16NO8P/c1-7(11)6(8)5(10)4(9)3(16-7)2-15-17(12,13)14/h3-6,9-11H,2,8H2,1H3,(H2,12,13,14)/t3-,4-,5+,6-,7-/m1/s1 |
| InChIKey | DCBCIKKSFQHIKZ-XUUWZHRGSA-N |
| XLogP | -2.75 |
| TPSA | 162.70 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.18 |
| LogP ≤ 5 | -2.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|