About O-[3-[2-(3-carbamothioyloxyphenyl)ethyl]phenyl] carbamothioate;hydrobromide
O-[3-[2-(3-carbamothioyloxyphenyl)ethyl]phenyl] carbamothioate;hydrobromide (PubChem CID 10201796) has the molecular formula C16H17BrN2O2S2
and a molecular weight of 413.36 g/mol. Its IUPAC name is O-[3-[2-(3-carbamothioyloxyphenyl)ethyl]phenyl] carbamothioate;hydrobromide.
Molecular Properties
| Compound Name | O-[3-[2-(3-carbamothioyloxyphenyl)ethyl]phenyl] carbamothioate;hydrobromide |
| PubChem CID | 10201796 |
| Molecular Formula | C16H17BrN2O2S2 |
| Molecular Weight | 413.36 g/mol |
| Exact Mass | 411.99 |
| IUPAC Name | O-[3-[2-(3-carbamothioyloxyphenyl)ethyl]phenyl] carbamothioate;hydrobromide |
| SMILES | Br.NC(=S)Oc1cccc(CCc2cccc(OC(N)=S)c2)c1 |
| InChI | InChI=1S/C16H16N2O2S2.BrH/c17-15(21)19-13-5-1-3-11(9-13)7-8-12-4-2-6-14(10-12)20-16(18)22;/h1-6,9-10H,7-8H2,(H2,17,21)(H2,18,22);1H |
| InChIKey | PEIWMADYYZCGRY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-[3-[2-(3-carbamothioyloxyphenyl)ethyl]phenyl] carbamothioate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[3-[2-(3-carbamothioyloxyphenyl)ethyl]phenyl] carbamothioate;hydrobromide?
The IUPAC name of O-[3-[2-(3-carbamothioyloxyphenyl)ethyl]phenyl] carbamothioate;hydrobromide (CID 10201796) is O-[3-[2-(3-carbamothioyloxyphenyl)ethyl]phenyl] carbamothioate;hydrobromide.
What is the SMILES notation for O-[3-[2-(3-carbamothioyloxyphenyl)ethyl]phenyl] carbamothioate;hydrobromide?
The canonical SMILES for O-[3-[2-(3-carbamothioyloxyphenyl)ethyl]phenyl] carbamothioate;hydrobromide is Br.NC(=S)Oc1cccc(CCc2cccc(OC(N)=S)c2)c1.
What is the InChIKey of O-[3-[2-(3-carbamothioyloxyphenyl)ethyl]phenyl] carbamothioate;hydrobromide?
The InChIKey is PEIWMADYYZCGRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O2S2.BrH/c17-15(21)19-13-5-1-3-11(9-13)7-8-12-4-2-6-14(10-12)20-16(18)22;/h1-6,9-10H,7-8H2,(H2,17,21)(H2,18,22);1H.
What are the key properties of O-[3-[2-(3-carbamothioyloxyphenyl)ethyl]phenyl] carbamothioate;hydrobromide?
O-[3-[2-(3-carbamothioyloxyphenyl)ethyl]phenyl] carbamothioate;hydrobromide has a molecular weight of 413.36 g/mol, XLogP of 3.29, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for O-[3-[2-(3-carbamothioyloxyphenyl)ethyl]phenyl] carbamothioate;hydrobromide is sourced from PubChem (CID 10201796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).