C20H20ClN5O3 — CID 10201827
(3R,4R)-4-[[4-[(2-chlorobenzimidazol-1-yl)methyl]benzoyl]amino]-N-hydroxypyrrolidine-3-carboxamide (PubChem CID 10201827) has the molecular formula C20H20ClN5O3 and a molecular weight of 413.87 g/mol. Its IUPAC name is (3R,4R)-4-[[4-[(2-chlorobenzimidazol-1-yl)methyl]benzoyl]amino]-N-hydroxypyrrolidine-3-carboxamide.
| Compound Name | (3R,4R)-4-[[4-[(2-chlorobenzimidazol-1-yl)methyl]benzoyl]amino]-N-hydroxypyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 10201827 |
| Molecular Formula | C20H20ClN5O3 |
| Molecular Weight | 413.87 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | (3R,4R)-4-[[4-[(2-chlorobenzimidazol-1-yl)methyl]benzoyl]amino]-N-hydroxypyrrolidine-3-carboxamide |
| SMILES | O=C(N[C@H]1CNC[C@H]1C(=O)NO)c1ccc(Cn2c(Cl)nc3ccccc32)cc1 |
| InChI | InChI=1S/C20H20ClN5O3/c21-20-24-15-3-1-2-4-17(15)26(20)11-12-5-7-13(8-6-12)18(27)23-16-10-22-9-14(16)19(28)25-29/h1-8,14,16,22,29H,9-11H2,(H,23,27)(H,25,28)/t14-,16+/m1/s1 |
| InChIKey | BXAGEIFKYQOAIG-ZBFHGGJFSA-N |
| XLogP | 1.56 |
| TPSA | 108.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.87 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|