C16H23N — CID 102018956
5,5-dimethyl-6-(3-phenylpropyl)-3,4-dihydro-2H-pyridine (PubChem CID 102018956) has the molecular formula C16H23N and a molecular weight of 229.37 g/mol. Its IUPAC name is 5,5-dimethyl-6-(3-phenylpropyl)-3,4-dihydro-2H-pyridine.
| Compound Name | 5,5-dimethyl-6-(3-phenylpropyl)-3,4-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 102018956 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | 5,5-dimethyl-6-(3-phenylpropyl)-3,4-dihydro-2H-pyridine |
| SMILES | CC1(C)CCCN=C1CCCc1ccccc1 |
| InChI | InChI=1S/C16H23N/c1-16(2)12-7-13-17-15(16)11-6-10-14-8-4-3-5-9-14/h3-5,8-9H,6-7,10-13H2,1-2H3 |
| InChIKey | NKUUQAJSAXVAEK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |