C18H36O3Si2 — CID 102020463
4,6-bis[[tert-butyl(dimethyl)silyl]oxy]hex-1-yn-3-one (PubChem CID 102020463) has the molecular formula C18H36O3Si2 and a molecular weight of 356.66 g/mol. Its IUPAC name is 4,6-bis[[tert-butyl(dimethyl)silyl]oxy]hex-1-yn-3-one.
| Compound Name | 4,6-bis[[tert-butyl(dimethyl)silyl]oxy]hex-1-yn-3-one |
|---|---|
| PubChem CID | 102020463 |
| Molecular Formula | C18H36O3Si2 |
| Molecular Weight | 356.66 g/mol |
| Exact Mass | 356.22 |
| IUPAC Name | 4,6-bis[[tert-butyl(dimethyl)silyl]oxy]hex-1-yn-3-one |
| SMILES | C#CC(=O)C(CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H36O3Si2/c1-12-15(19)16(21-23(10,11)18(5,6)7)13-14-20-22(8,9)17(2,3)4/h1,16H,13-14H2,2-11H3 |
| InChIKey | XFWDBLHTCKYCBP-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.66 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|