C16H20N2O3S — CID 102024269
S-[2-(4-amino-4-oxobutanoyl)phenyl] N-cyclopentylcarbamothioate (PubChem CID 102024269) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is S-[2-(4-amino-4-oxobutanoyl)phenyl] N-cyclopentylcarbamothioate.
| Compound Name | S-[2-(4-amino-4-oxobutanoyl)phenyl] N-cyclopentylcarbamothioate |
|---|---|
| PubChem CID | 102024269 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | S-[2-(4-amino-4-oxobutanoyl)phenyl] N-cyclopentylcarbamothioate |
| SMILES | NC(=O)CCC(=O)c1ccccc1SC(=O)NC1CCCC1 |
| InChI | InChI=1S/C16H20N2O3S/c17-15(20)10-9-13(19)12-7-3-4-8-14(12)22-16(21)18-11-5-1-2-6-11/h3-4,7-8,11H,1-2,5-6,9-10H2,(H2,17,20)(H,18,21) |
| InChIKey | IEDQCJJMOZLBDK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|