C19H19N3O5S — CID 102025768
(2R)-1-(4-nitrophenyl)sulfonyl-N-[(2-prop-2-enylphenyl)methyl]aziridine-2-carboxamide (PubChem CID 102025768) has the molecular formula C19H19N3O5S and a molecular weight of 401.44 g/mol. Its IUPAC name is (2R)-1-(4-nitrophenyl)sulfonyl-N-[(2-prop-2-enylphenyl)methyl]aziridine-2-carboxamide.
| Compound Name | (2R)-1-(4-nitrophenyl)sulfonyl-N-[(2-prop-2-enylphenyl)methyl]aziridine-2-carboxamide |
|---|---|
| PubChem CID | 102025768 |
| Molecular Formula | C19H19N3O5S |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | (2R)-1-(4-nitrophenyl)sulfonyl-N-[(2-prop-2-enylphenyl)methyl]aziridine-2-carboxamide |
| SMILES | C=CCc1ccccc1CNC(=O)[C@H]1CN1S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H19N3O5S/c1-2-5-14-6-3-4-7-15(14)12-20-19(23)18-13-21(18)28(26,27)17-10-8-16(9-11-17)22(24)25/h2-4,6-11,18H,1,5,12-13H2,(H,20,23)/t18-,21?/m1/s1 |
| InChIKey | GWHXPEJXGQHNOR-ITUIMRKVSA-N |
| XLogP | 2.01 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|