C34H35N2O4P — CID 102026462
4-[(R)-[(4S,5S)-4,5-diphenyl-1,3,2-dioxaphospholan-2-yl]oxy-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]-6-methoxyquinoline (PubChem CID 102026462) has the molecular formula C34H35N2O4P and a molecular weight of 566.64 g/mol. Its IUPAC name is 4-[(R)-[(4S,5S)-4,5-diphenyl-1,3,2-dioxaphospholan-2-yl]oxy-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]-6-methoxyquinoline.
| Compound Name | 4-[(R)-[(4S,5S)-4,5-diphenyl-1,3,2-dioxaphospholan-2-yl]oxy-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]-6-methoxyquinoline |
|---|---|
| PubChem CID | 102026462 |
| Molecular Formula | C34H35N2O4P |
| Molecular Weight | 566.64 g/mol |
| Exact Mass | 566.23 |
| IUPAC Name | 4-[(R)-[(4S,5S)-4,5-diphenyl-1,3,2-dioxaphospholan-2-yl]oxy-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]-6-methoxyquinoline |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@H]2[C@H](OP1O[C@@H](c2ccccc2)[C@H](c2ccccc2)O1)c1ccnc2ccc(OC)cc12 |
| InChI | InChI=1S/C34H35N2O4P/c1-3-23-22-36-19-17-26(23)20-31(36)34(28-16-18-35-30-15-14-27(37-2)21-29(28)30)40-41-38-32(24-10-6-4-7-11-24)33(39-41)25-12-8-5-9-13-25/h3-16,18,21,23,26,31-34H,1,17,19-20,22H2,2H3/t23-,26-,31-,32-,33-,34+/m0/s1 |
| InChIKey | ONUHYHWXMJTJFL-HIKLZYFXSA-N |
| XLogP | 7.95 |
| TPSA | 53.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.64 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|