C50H52N6 — CID 102026708
2,7-ditert-butyl-9-[diazo-[3-[diazo-(2,7-ditert-butylacridin-9-yl)methyl]phenyl]methyl]acridine (PubChem CID 102026708) has the molecular formula C50H52N6 and a molecular weight of 737.01 g/mol. Its IUPAC name is 2,7-ditert-butyl-9-[diazo-[3-[diazo-(2,7-ditert-butylacridin-9-yl)methyl]phenyl]methyl]acridine.
| Compound Name | 2,7-ditert-butyl-9-[diazo-[3-[diazo-(2,7-ditert-butylacridin-9-yl)methyl]phenyl]methyl]acridine |
|---|---|
| PubChem CID | 102026708 |
| Molecular Formula | C50H52N6 |
| Molecular Weight | 737.01 g/mol |
| Exact Mass | 736.43 |
| IUPAC Name | 2,7-ditert-butyl-9-[diazo-[3-[diazo-(2,7-ditert-butylacridin-9-yl)methyl]phenyl]methyl]acridine |
| SMILES | CC(C)(C)c1ccc2nc3ccc(C(C)(C)C)cc3c(C(=[N+]=[N-])c3cccc(C(=[N+]=[N-])c4c5cc(C(C)(C)C)ccc5nc5ccc(C(C)(C)C)cc45)c3)c2c1 |
| InChI | InChI=1S/C50H52N6/c1-47(2,3)31-16-20-39-35(25-31)43(36-26-32(48(4,5)6)17-21-40(36)53-39)45(55-51)29-14-13-15-30(24-29)46(56-52)44-37-27-33(49(7,8)9)18-22-41(37)54-42-23-19-34(28-38(42)44)50(10,11)12/h13-28H,1-12H3 |
| InChIKey | SMECWJAWHBLBTJ-UHFFFAOYSA-N |
| XLogP | 12.41 |
| TPSA | 98.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.01 |
| LogP ≤ 5 | 12.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|