C33H24F10N2 — CID 102374217
1-[5-tert-butyl-2-[(4-tert-butylphenyl)-diazomethyl]-3-(2,3,4,5,6-pentafluorophenyl)phenyl]-2,3,4,5,6-pentafluorobenzene (PubChem CID 102374217) has the molecular formula C33H24F10N2 and a molecular weight of 638.55 g/mol. Its IUPAC name is 1-[5-tert-butyl-2-[(4-tert-butylphenyl)-diazomethyl]-3-(2,3,4,5,6-pentafluorophenyl)phenyl]-2,3,4,5,6-pentafluorobenzene.
| Compound Name | 1-[5-tert-butyl-2-[(4-tert-butylphenyl)-diazomethyl]-3-(2,3,4,5,6-pentafluorophenyl)phenyl]-2,3,4,5,6-pentafluorobenzene |
|---|---|
| PubChem CID | 102374217 |
| Molecular Formula | C33H24F10N2 |
| Molecular Weight | 638.55 g/mol |
| Exact Mass | 638.18 |
| IUPAC Name | 1-[5-tert-butyl-2-[(4-tert-butylphenyl)-diazomethyl]-3-(2,3,4,5,6-pentafluorophenyl)phenyl]-2,3,4,5,6-pentafluorobenzene |
| SMILES | CC(C)(C)c1ccc(C(=[N+]=[N-])c2c(-c3c(F)c(F)c(F)c(F)c3F)cc(C(C)(C)C)cc2-c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C33H24F10N2/c1-32(2,3)14-9-7-13(8-10-14)31(45-44)18-16(19-21(34)25(38)29(42)26(39)22(19)35)11-15(33(4,5)6)12-17(18)20-23(36)27(40)30(43)28(41)24(20)37/h7-12H,1-6H3 |
| InChIKey | VKTYULAAYZKSPO-UHFFFAOYSA-N |
| XLogP | 10.07 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.55 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|