C43H34F5N5 — CID 102097241
16,17-bis(4-tert-butylphenyl)-7-(2,3,4,5,6-pentafluorophenyl)-2,12,20,21,22-pentazapentacyclo[11.6.1.13,6.18,11.014,19]docosa-1(20),2,4,6,8,10,12,14(19),15,17-decaene (PubChem CID 102097241) has the molecular formula C43H34F5N5 and a molecular weight of 715.77 g/mol. Its IUPAC name is 16,17-bis(4-tert-butylphenyl)-7-(2,3,4,5,6-pentafluorophenyl)-2,12,20,21,22-pentazapentacyclo[11.6.1.13,6.18,11.014,19]docosa-1(20),2,4,6,8,10,12,14(19),15,17-decaene.
| Compound Name | 16,17-bis(4-tert-butylphenyl)-7-(2,3,4,5,6-pentafluorophenyl)-2,12,20,21,22-pentazapentacyclo[11.6.1.13,6.18,11.014,19]docosa-1(20),2,4,6,8,10,12,14(19),15,17-decaene |
|---|---|
| PubChem CID | 102097241 |
| Molecular Formula | C43H34F5N5 |
| Molecular Weight | 715.77 g/mol |
| Exact Mass | 715.27 |
| IUPAC Name | 16,17-bis(4-tert-butylphenyl)-7-(2,3,4,5,6-pentafluorophenyl)-2,12,20,21,22-pentazapentacyclo[11.6.1.13,6.18,11.014,19]docosa-1(20),2,4,6,8,10,12,14(19),15,17-decaene |
| SMILES | CC(C)(C)c1ccc(-c2cc3c(cc2-c2ccc(C(C)(C)C)cc2)-c2nc-3nc3ccc([nH]3)c(-c3c(F)c(F)c(F)c(F)c3F)c3ccc(n2)[nH]3)cc1 |
| InChI | InChI=1S/C43H34F5N5/c1-42(2,3)23-11-7-21(8-12-23)25-19-27-28(20-26(25)22-9-13-24(14-10-22)43(4,5)6)41-52-32-18-16-30(50-32)33(29-15-17-31(49-29)51-40(27)53-41)34-35(44)37(46)39(48)38(47)36(34)45/h7-20H,1-6H3,(H2,49,50,51,52,53) |
| InChIKey | SQZAMGNGMDEFAO-UHFFFAOYSA-N |
| XLogP | 11.90 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.77 |
| LogP ≤ 5 | 11.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|