About methyl 4-[[3-[(E)-2-(1-methyl-2,3-dihydro-1,4-benzodiazepin-5-yl)ethenyl]phenoxy]methyl]benzoate
methyl 4-[[3-[(E)-2-(1-methyl-2,3-dihydro-1,4-benzodiazepin-5-yl)ethenyl]phenoxy]methyl]benzoate (PubChem CID 10202710) has the molecular formula C27H26N2O3
and a molecular weight of 426.52 g/mol. Its IUPAC name is methyl 4-[[3-[(E)-2-(1-methyl-2,3-dihydro-1,4-benzodiazepin-5-yl)ethenyl]phenoxy]methyl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[[3-[(E)-2-(1-methyl-2,3-dihydro-1,4-benzodiazepin-5-yl)ethenyl]phenoxy]methyl]benzoate |
| PubChem CID | 10202710 |
| Molecular Formula | C27H26N2O3 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | methyl 4-[[3-[(E)-2-(1-methyl-2,3-dihydro-1,4-benzodiazepin-5-yl)ethenyl]phenoxy]methyl]benzoate |
| SMILES | COC(=O)c1ccc(COc2cccc(/C=C/C3=NCCN(C)c4ccccc43)c2)cc1 |
| InChI | InChI=1S/C27H26N2O3/c1-29-17-16-28-25(24-8-3-4-9-26(24)29)15-12-20-6-5-7-23(18-20)32-19-21-10-13-22(14-11-21)27(30)31-2/h3-15,18H,16-17,19H2,1-2H3/b15-12+ |
| InChIKey | NSDHRWXGHOEREZ-NTCAYCPXSA-N |
| XLogP | 5.00 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 4-[[3-[(E)-2-(1-methyl-2,3-dihydro-1,4-benzodiazepin-5-yl)ethenyl]phenoxy]methyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[[3-[(E)-2-(1-methyl-2,3-dihydro-1,4-benzodiazepin-5-yl)ethenyl]phenoxy]methyl]benzoate?
The IUPAC name of methyl 4-[[3-[(E)-2-(1-methyl-2,3-dihydro-1,4-benzodiazepin-5-yl)ethenyl]phenoxy]methyl]benzoate (CID 10202710) is methyl 4-[[3-[(E)-2-(1-methyl-2,3-dihydro-1,4-benzodiazepin-5-yl)ethenyl]phenoxy]methyl]benzoate.
What is the SMILES notation for methyl 4-[[3-[(E)-2-(1-methyl-2,3-dihydro-1,4-benzodiazepin-5-yl)ethenyl]phenoxy]methyl]benzoate?
The canonical SMILES for methyl 4-[[3-[(E)-2-(1-methyl-2,3-dihydro-1,4-benzodiazepin-5-yl)ethenyl]phenoxy]methyl]benzoate is COC(=O)c1ccc(COc2cccc(/C=C/C3=NCCN(C)c4ccccc43)c2)cc1.
What is the InChIKey of methyl 4-[[3-[(E)-2-(1-methyl-2,3-dihydro-1,4-benzodiazepin-5-yl)ethenyl]phenoxy]methyl]benzoate?
The InChIKey is NSDHRWXGHOEREZ-NTCAYCPXSA-N. The full InChI is InChI=1S/C27H26N2O3/c1-29-17-16-28-25(24-8-3-4-9-26(24)29)15-12-20-6-5-7-23(18-20)32-19-21-10-13-22(14-11-21)27(30)31-2/h3-15,18H,16-17,19H2,1-2H3/b15-12+.
What are the key properties of methyl 4-[[3-[(E)-2-(1-methyl-2,3-dihydro-1,4-benzodiazepin-5-yl)ethenyl]phenoxy]methyl]benzoate?
methyl 4-[[3-[(E)-2-(1-methyl-2,3-dihydro-1,4-benzodiazepin-5-yl)ethenyl]phenoxy]methyl]benzoate has a molecular weight of 426.52 g/mol, XLogP of 5.00, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[[3-[(E)-2-(1-methyl-2,3-dihydro-1,4-benzodiazepin-5-yl)ethenyl]phenoxy]methyl]benzoate is sourced from PubChem (CID 10202710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).