C25H23ClO8 — CID 102028624
trimethyl (Z,2S)-2-(3-chlorophenyl)-4-[(E)-3-phenylprop-2-enoyl]oxybut-3-ene-1,1,4-tricarboxylate (PubChem CID 102028624) has the molecular formula C25H23ClO8 and a molecular weight of 486.90 g/mol. Its IUPAC name is trimethyl (Z,2S)-2-(3-chlorophenyl)-4-[(E)-3-phenylprop-2-enoyl]oxybut-3-ene-1,1,4-tricarboxylate.
| Compound Name | trimethyl (Z,2S)-2-(3-chlorophenyl)-4-[(E)-3-phenylprop-2-enoyl]oxybut-3-ene-1,1,4-tricarboxylate |
|---|---|
| PubChem CID | 102028624 |
| Molecular Formula | C25H23ClO8 |
| Molecular Weight | 486.90 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | trimethyl (Z,2S)-2-(3-chlorophenyl)-4-[(E)-3-phenylprop-2-enoyl]oxybut-3-ene-1,1,4-tricarboxylate |
| SMILES | COC(=O)/C(=C/[C@H](c1cccc(Cl)c1)C(C(=O)OC)C(=O)OC)OC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C25H23ClO8/c1-31-23(28)20(34-21(27)13-12-16-8-5-4-6-9-16)15-19(17-10-7-11-18(26)14-17)22(24(29)32-2)25(30)33-3/h4-15,19,22H,1-3H3/b13-12+,20-15-/t19-/m1/s1 |
| InChIKey | PHXJESBIABWRIJ-YKCFETMWSA-N |
| XLogP | 3.70 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.90 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|