C14H17N3O2S — CID 102029363
3-phenyl-5-(thiomorpholin-4-ylmethyl)imidazolidine-2,4-dione (PubChem CID 102029363) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is 3-phenyl-5-(thiomorpholin-4-ylmethyl)imidazolidine-2,4-dione.
| Compound Name | 3-phenyl-5-(thiomorpholin-4-ylmethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 102029363 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 3-phenyl-5-(thiomorpholin-4-ylmethyl)imidazolidine-2,4-dione |
| SMILES | O=C1NC(CN2CCSCC2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C14H17N3O2S/c18-13-12(10-16-6-8-20-9-7-16)15-14(19)17(13)11-4-2-1-3-5-11/h1-5,12H,6-10H2,(H,15,19) |
| InChIKey | SODCKWMDWQGZHY-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|