C7H14O3S2 — CID 102031500
(2R,3S,5S)-5-(ethyldisulfanyl)-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 102031500) has the molecular formula C7H14O3S2 and a molecular weight of 210.32 g/mol. Its IUPAC name is (2R,3S,5S)-5-(ethyldisulfanyl)-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3S,5S)-5-(ethyldisulfanyl)-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 102031500 |
| Molecular Formula | C7H14O3S2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | (2R,3S,5S)-5-(ethyldisulfanyl)-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | CCSS[C@H]1C[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C7H14O3S2/c1-2-11-12-7-3-5(9)6(4-8)10-7/h5-9H,2-4H2,1H3/t5-,6+,7-/m0/s1 |
| InChIKey | AUEVMSMBSYTRBC-XVMARJQXSA-N |
| XLogP | 0.86 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|