C20H21N3O4 — CID 102036298
methyl 2-[[2-[[(2S)-pyrrolidine-2-carbonyl]amino]benzoyl]amino]benzoate (PubChem CID 102036298) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is methyl 2-[[2-[[(2S)-pyrrolidine-2-carbonyl]amino]benzoyl]amino]benzoate.
| Compound Name | methyl 2-[[2-[[(2S)-pyrrolidine-2-carbonyl]amino]benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 102036298 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | methyl 2-[[2-[[(2S)-pyrrolidine-2-carbonyl]amino]benzoyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)c1ccccc1NC(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C20H21N3O4/c1-27-20(26)14-8-3-5-10-16(14)22-18(24)13-7-2-4-9-15(13)23-19(25)17-11-6-12-21-17/h2-5,7-10,17,21H,6,11-12H2,1H3,(H,22,24)(H,23,25)/t17-/m0/s1 |
| InChIKey | QJDOHYKKPBBIIV-KRWDZBQOSA-N |
| XLogP | 2.42 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |