About (E)-4-[2-(3,3-dimethylbut-1-ynyl)phenyl]but-2-en-1-ol
(E)-4-[2-(3,3-dimethylbut-1-ynyl)phenyl]but-2-en-1-ol (PubChem CID 102036586) has the molecular formula C16H20O
and a molecular weight of 228.34 g/mol. Its IUPAC name is (E)-4-[2-(3,3-dimethylbut-1-ynyl)phenyl]but-2-en-1-ol.
Molecular Properties
| Compound Name | (E)-4-[2-(3,3-dimethylbut-1-ynyl)phenyl]but-2-en-1-ol |
| PubChem CID | 102036586 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | (E)-4-[2-(3,3-dimethylbut-1-ynyl)phenyl]but-2-en-1-ol |
| SMILES | CC(C)(C)C#Cc1ccccc1C/C=C/CO |
| InChI | InChI=1S/C16H20O/c1-16(2,3)12-11-15-9-5-4-8-14(15)10-6-7-13-17/h4-9,17H,10,13H2,1-3H3/b7-6+ |
| InChIKey | CBAAFVMBALEKKJ-VOTSOKGWSA-N |
| XLogP | 3.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-[2-(3,3-dimethylbut-1-ynyl)phenyl]but-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-[2-(3,3-dimethylbut-1-ynyl)phenyl]but-2-en-1-ol?
The IUPAC name of (E)-4-[2-(3,3-dimethylbut-1-ynyl)phenyl]but-2-en-1-ol (CID 102036586) is (E)-4-[2-(3,3-dimethylbut-1-ynyl)phenyl]but-2-en-1-ol.
What is the SMILES notation for (E)-4-[2-(3,3-dimethylbut-1-ynyl)phenyl]but-2-en-1-ol?
The canonical SMILES for (E)-4-[2-(3,3-dimethylbut-1-ynyl)phenyl]but-2-en-1-ol is CC(C)(C)C#Cc1ccccc1C/C=C/CO.
What is the InChIKey of (E)-4-[2-(3,3-dimethylbut-1-ynyl)phenyl]but-2-en-1-ol?
The InChIKey is CBAAFVMBALEKKJ-VOTSOKGWSA-N. The full InChI is InChI=1S/C16H20O/c1-16(2,3)12-11-15-9-5-4-8-14(15)10-6-7-13-17/h4-9,17H,10,13H2,1-3H3/b7-6+.
What are the key properties of (E)-4-[2-(3,3-dimethylbut-1-ynyl)phenyl]but-2-en-1-ol?
(E)-4-[2-(3,3-dimethylbut-1-ynyl)phenyl]but-2-en-1-ol has a molecular weight of 228.34 g/mol, XLogP of 3.18, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-[2-(3,3-dimethylbut-1-ynyl)phenyl]but-2-en-1-ol is sourced from PubChem (CID 102036586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).