C12H20N2 — CID 102040605
N,N'-di(propan-2-yl)cyclopenta-2,4-diene-1-carboximidamide (PubChem CID 102040605) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is N,N'-di(propan-2-yl)cyclopenta-2,4-diene-1-carboximidamide.
| Compound Name | N,N'-di(propan-2-yl)cyclopenta-2,4-diene-1-carboximidamide |
|---|---|
| PubChem CID | 102040605 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | N,N'-di(propan-2-yl)cyclopenta-2,4-diene-1-carboximidamide |
| SMILES | CC(C)/N=C(/NC(C)C)C1C=CC=C1 |
| InChI | InChI=1S/C12H20N2/c1-9(2)13-12(14-10(3)4)11-7-5-6-8-11/h5-11H,1-4H3,(H,13,14) |
| InChIKey | OKPCIDDZOIYPBX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|