C11H13N2O6S2+ — CID 102041256
4-[3-(2-sulfoethyl)imidazol-3-ium-1-yl]benzenesulfonic acid (PubChem CID 102041256) has the molecular formula C11H13N2O6S2+ and a molecular weight of 333.37 g/mol. Its IUPAC name is 4-[3-(2-sulfoethyl)imidazol-3-ium-1-yl]benzenesulfonic acid.
| Compound Name | 4-[3-(2-sulfoethyl)imidazol-3-ium-1-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 102041256 |
| Molecular Formula | C11H13N2O6S2+ |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | 4-[3-(2-sulfoethyl)imidazol-3-ium-1-yl]benzenesulfonic acid |
| SMILES | O=S(=O)(O)CC[n+]1ccn(-c2ccc(S(=O)(=O)O)cc2)c1 |
| InChI | InChI=1S/C11H12N2O6S2/c14-20(15,16)8-7-12-5-6-13(9-12)10-1-3-11(4-2-10)21(17,18)19/h1-6,9H,7-8H2,(H-,14,15,16,17,18,19)/p+1 |
| InChIKey | JQVITLUWFRLVFR-UHFFFAOYSA-O |
| XLogP | -0.10 |
| TPSA | 117.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|