C11H20O5 — CID 102044354
(2R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[(2S,3R)-3-(hydroxymethyl)oxiran-2-yl]propan-2-ol (PubChem CID 102044354) has the molecular formula C11H20O5 and a molecular weight of 232.28 g/mol. Its IUPAC name is (2R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[(2S,3R)-3-(hydroxymethyl)oxiran-2-yl]propan-2-ol.
| Compound Name | (2R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[(2S,3R)-3-(hydroxymethyl)oxiran-2-yl]propan-2-ol |
|---|---|
| PubChem CID | 102044354 |
| Molecular Formula | C11H20O5 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | (2R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[(2S,3R)-3-(hydroxymethyl)oxiran-2-yl]propan-2-ol |
| SMILES | CC1(C)OC[C@H](C[C@@](C)(O)[C@H]2O[C@@H]2CO)O1 |
| InChI | InChI=1S/C11H20O5/c1-10(2)14-6-7(16-10)4-11(3,13)9-8(5-12)15-9/h7-9,12-13H,4-6H2,1-3H3/t7-,8+,9-,11+/m0/s1 |
| InChIKey | FYQJZZOMGHTZQF-QCBRBAQYSA-N |
| XLogP | 0.04 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|