C24H20O2S3 — CID 102044925
[10-[hydroxy-(4-methylphenyl)methyl]-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-(4-methylphenyl)methanol (PubChem CID 102044925) has the molecular formula C24H20O2S3 and a molecular weight of 436.62 g/mol. Its IUPAC name is [10-[hydroxy-(4-methylphenyl)methyl]-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-(4-methylphenyl)methanol.
| Compound Name | [10-[hydroxy-(4-methylphenyl)methyl]-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-(4-methylphenyl)methanol |
|---|---|
| PubChem CID | 102044925 |
| Molecular Formula | C24H20O2S3 |
| Molecular Weight | 436.62 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | [10-[hydroxy-(4-methylphenyl)methyl]-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-(4-methylphenyl)methanol |
| SMILES | Cc1ccc(C(O)c2cc3sc4cc(C(O)c5ccc(C)cc5)sc4c3s2)cc1 |
| InChI | InChI=1S/C24H20O2S3/c1-13-3-7-15(8-4-13)21(25)17-11-19-23(28-17)24-20(27-19)12-18(29-24)22(26)16-9-5-14(2)6-10-16/h3-12,21-22,25-26H,1-2H3 |
| InChIKey | NGDBMRIREKWXAM-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.62 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |