C26H27N3O5 — CID 10204898
7-[[4-[(Z)-[(5Z)-5-benzylidene-3,6-dioxopiperazin-2-ylidene]methyl]benzoyl]amino]heptanoic acid (PubChem CID 10204898) has the molecular formula C26H27N3O5 and a molecular weight of 461.52 g/mol. Its IUPAC name is 7-[[4-[(Z)-[(5Z)-5-benzylidene-3,6-dioxopiperazin-2-ylidene]methyl]benzoyl]amino]heptanoic acid.
| Compound Name | 7-[[4-[(Z)-[(5Z)-5-benzylidene-3,6-dioxopiperazin-2-ylidene]methyl]benzoyl]amino]heptanoic acid |
|---|---|
| PubChem CID | 10204898 |
| Molecular Formula | C26H27N3O5 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | 7-[[4-[(Z)-[(5Z)-5-benzylidene-3,6-dioxopiperazin-2-ylidene]methyl]benzoyl]amino]heptanoic acid |
| SMILES | O=C(O)CCCCCCNC(=O)c1ccc(/C=c2\[nH]c(=O)/c(=C/c3ccccc3)[nH]c2=O)cc1 |
| InChI | InChI=1S/C26H27N3O5/c30-23(31)10-6-1-2-7-15-27-24(32)20-13-11-19(12-14-20)17-22-26(34)28-21(25(33)29-22)16-18-8-4-3-5-9-18/h3-5,8-9,11-14,16-17H,1-2,6-7,10,15H2,(H,27,32)(H,28,34)(H,29,33)(H,30,31)/b21-16-,22-17- |
| InChIKey | ISJAUZYQWPLJMW-QLBLWQCWSA-N |
| XLogP | 1.49 |
| TPSA | 132.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|