C19H30O4 — CID 102050111
(2R,6R)-2-[(1E,3E)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylpenta-1,3-dienyl]-6-propan-2-yloxy-3,6-dihydro-2H-pyran (PubChem CID 102050111) has the molecular formula C19H30O4 and a molecular weight of 322.45 g/mol. Its IUPAC name is (2R,6R)-2-[(1E,3E)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylpenta-1,3-dienyl]-6-propan-2-yloxy-3,6-dihydro-2H-pyran.
| Compound Name | (2R,6R)-2-[(1E,3E)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylpenta-1,3-dienyl]-6-propan-2-yloxy-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 102050111 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | (2R,6R)-2-[(1E,3E)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methylpenta-1,3-dienyl]-6-propan-2-yloxy-3,6-dihydro-2H-pyran |
| SMILES | CC(/C=C/[C@H]1CC=C[C@H](OC(C)C)O1)=C\C[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C19H30O4/c1-14(2)21-18-8-6-7-16(22-18)11-9-15(3)10-12-17-13-20-19(4,5)23-17/h6,8-11,14,16-18H,7,12-13H2,1-5H3/b11-9+,15-10+/t16-,17-,18-/m1/s1 |
| InChIKey | WBXKUMQAXQCWSS-CNWQSZQRSA-N |
| XLogP | 4.13 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|