C23H27N2O2+ — CID 102050287
ethyl 2-(1-tert-butylspiro[4H-imidazol-3-ium-5,9'-fluorene]-3-yl)acetate (PubChem CID 102050287) has the molecular formula C23H27N2O2+ and a molecular weight of 363.48 g/mol. Its IUPAC name is ethyl 2-(1-tert-butylspiro[4H-imidazol-3-ium-5,9'-fluorene]-3-yl)acetate.
| Compound Name | ethyl 2-(1-tert-butylspiro[4H-imidazol-3-ium-5,9'-fluorene]-3-yl)acetate |
|---|---|
| PubChem CID | 102050287 |
| Molecular Formula | C23H27N2O2+ |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | ethyl 2-(1-tert-butylspiro[4H-imidazol-3-ium-5,9'-fluorene]-3-yl)acetate |
| SMILES | CCOC(=O)C[N+]1=CN(C(C)(C)C)C2(C1)c1ccccc1-c1ccccc12 |
| InChI | InChI=1S/C23H27N2O2/c1-5-27-21(26)14-24-15-23(25(16-24)22(2,3)4)19-12-8-6-10-17(19)18-11-7-9-13-20(18)23/h6-13,16H,5,14-15H2,1-4H3/q+1 |
| InChIKey | CRUCDQFKEMCRJY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 32.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|