C17H20O3 — CID 177496466
ethyl 2-[(1R)-4-oxo-1-propylnaphthalen-1-yl]acetate (PubChem CID 177496466) has the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. Its IUPAC name is ethyl 2-[(1R)-4-oxo-1-propylnaphthalen-1-yl]acetate.
| Compound Name | ethyl 2-[(1R)-4-oxo-1-propylnaphthalen-1-yl]acetate |
|---|---|
| PubChem CID | 177496466 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | ethyl 2-[(1R)-4-oxo-1-propylnaphthalen-1-yl]acetate |
| SMILES | CCC[C@@]1(CC(=O)OCC)C=CC(=O)c2ccccc21 |
| InChI | InChI=1S/C17H20O3/c1-3-10-17(12-16(19)20-4-2)11-9-15(18)13-7-5-6-8-14(13)17/h5-9,11H,3-4,10,12H2,1-2H3/t17-/m0/s1 |
| InChIKey | VRNDLBNTNBXSCM-KRWDZBQOSA-N |
| XLogP | 3.43 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |