C17H24O4 — CID 102050988
(R)-[(1R)-2-(2-methoxyethoxymethoxy)cyclohex-2-en-1-yl]-phenylmethanol (PubChem CID 102050988) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is (R)-[(1R)-2-(2-methoxyethoxymethoxy)cyclohex-2-en-1-yl]-phenylmethanol.
| Compound Name | (R)-[(1R)-2-(2-methoxyethoxymethoxy)cyclohex-2-en-1-yl]-phenylmethanol |
|---|---|
| PubChem CID | 102050988 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | (R)-[(1R)-2-(2-methoxyethoxymethoxy)cyclohex-2-en-1-yl]-phenylmethanol |
| SMILES | COCCOCOC1=CCCC[C@@H]1[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C17H24O4/c1-19-11-12-20-13-21-16-10-6-5-9-15(16)17(18)14-7-3-2-4-8-14/h2-4,7-8,10,15,17-18H,5-6,9,11-13H2,1H3/t15-,17-/m0/s1 |
| InChIKey | PJOSBVWCJQWPQW-RDJZCZTQSA-N |
| XLogP | 3.04 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|