C18H33NO7 — CID 102054130
tert-butyl (4S)-4-[(1S,2S)-1,2-bis(methoxymethoxy)but-3-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 102054130) has the molecular formula C18H33NO7 and a molecular weight of 375.46 g/mol. Its IUPAC name is tert-butyl (4S)-4-[(1S,2S)-1,2-bis(methoxymethoxy)but-3-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-4-[(1S,2S)-1,2-bis(methoxymethoxy)but-3-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 102054130 |
| Molecular Formula | C18H33NO7 |
| Molecular Weight | 375.46 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | tert-butyl (4S)-4-[(1S,2S)-1,2-bis(methoxymethoxy)but-3-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | C=C[C@H](OCOC)[C@@H](OCOC)[C@@H]1COC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H33NO7/c1-9-14(23-11-21-7)15(24-12-22-8)13-10-25-18(5,6)19(13)16(20)26-17(2,3)4/h9,13-15H,1,10-12H2,2-8H3/t13-,14-,15-/m0/s1 |
| InChIKey | AWRNOAHQYWEGMF-KKUMJFAQSA-N |
| XLogP | 2.52 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.46 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|