C10H10N2O — CID 102055214
2-[(E)-4,4-dimethyl-5-oxopent-2-enylidene]propanedinitrile (PubChem CID 102055214) has the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. Its IUPAC name is 2-[(E)-4,4-dimethyl-5-oxopent-2-enylidene]propanedinitrile.
| Compound Name | 2-[(E)-4,4-dimethyl-5-oxopent-2-enylidene]propanedinitrile |
|---|---|
| PubChem CID | 102055214 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 2-[(E)-4,4-dimethyl-5-oxopent-2-enylidene]propanedinitrile |
| SMILES | CC(C)(C=O)/C=C/C=C(C#N)C#N |
| InChI | InChI=1S/C10H10N2O/c1-10(2,8-13)5-3-4-9(6-11)7-12/h3-5,8H,1-2H3/b5-3+ |
| InChIKey | CANOXNKBTGZKLS-HWKANZROSA-N |
| XLogP | 1.74 |
| TPSA | 64.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|