C25H38N4O4S — CID 102056034
3-ethyl-N-[2-[4-[(4-ethylcyclohexyl)carbamoylsulfamoyl]phenyl]ethyl]-4-methyl-2,5-dihydropyrrole-1-carboxamide (PubChem CID 102056034) has the molecular formula C25H38N4O4S and a molecular weight of 490.67 g/mol. Its IUPAC name is 3-ethyl-N-[2-[4-[(4-ethylcyclohexyl)carbamoylsulfamoyl]phenyl]ethyl]-4-methyl-2,5-dihydropyrrole-1-carboxamide.
| Compound Name | 3-ethyl-N-[2-[4-[(4-ethylcyclohexyl)carbamoylsulfamoyl]phenyl]ethyl]-4-methyl-2,5-dihydropyrrole-1-carboxamide |
|---|---|
| PubChem CID | 102056034 |
| Molecular Formula | C25H38N4O4S |
| Molecular Weight | 490.67 g/mol |
| Exact Mass | 490.26 |
| IUPAC Name | 3-ethyl-N-[2-[4-[(4-ethylcyclohexyl)carbamoylsulfamoyl]phenyl]ethyl]-4-methyl-2,5-dihydropyrrole-1-carboxamide |
| SMILES | CCC1=C(C)CN(C(=O)NCCc2ccc(S(=O)(=O)NC(=O)NC3CCC(CC)CC3)cc2)C1 |
| InChI | InChI=1S/C25H38N4O4S/c1-4-19-6-10-22(11-7-19)27-24(30)28-34(32,33)23-12-8-20(9-13-23)14-15-26-25(31)29-16-18(3)21(5-2)17-29/h8-9,12-13,19,22H,4-7,10-11,14-17H2,1-3H3,(H,26,31)(H2,27,28,30) |
| InChIKey | GVYQVSKXBYUUQK-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.67 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|