C27H32O6 — CID 102057075
2-[5-(3-methylbut-2-enoxy)-2-[3-[4-(3-methylbut-2-enoxy)phenyl]propanoyl]phenoxy]acetic acid (PubChem CID 102057075) has the molecular formula C27H32O6 and a molecular weight of 452.55 g/mol. Its IUPAC name is 2-[5-(3-methylbut-2-enoxy)-2-[3-[4-(3-methylbut-2-enoxy)phenyl]propanoyl]phenoxy]acetic acid.
| Compound Name | 2-[5-(3-methylbut-2-enoxy)-2-[3-[4-(3-methylbut-2-enoxy)phenyl]propanoyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 102057075 |
| Molecular Formula | C27H32O6 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 2-[5-(3-methylbut-2-enoxy)-2-[3-[4-(3-methylbut-2-enoxy)phenyl]propanoyl]phenoxy]acetic acid |
| SMILES | CC(C)=CCOc1ccc(CCC(=O)c2ccc(OCC=C(C)C)cc2OCC(=O)O)cc1 |
| InChI | InChI=1S/C27H32O6/c1-19(2)13-15-31-22-8-5-21(6-9-22)7-12-25(28)24-11-10-23(32-16-14-20(3)4)17-26(24)33-18-27(29)30/h5-6,8-11,13-14,17H,7,12,15-16,18H2,1-4H3,(H,29,30) |
| InChIKey | RQUXKWZCYVMEEM-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|