C10H16O2S2 — CID 102060185
(1R)-1-[(2R)-1-oxo-2-[(E)-prop-1-enyl]-1,3-dithian-2-yl]prop-2-en-1-ol (PubChem CID 102060185) has the molecular formula C10H16O2S2 and a molecular weight of 232.37 g/mol. Its IUPAC name is (1R)-1-[(2R)-1-oxo-2-[(E)-prop-1-enyl]-1,3-dithian-2-yl]prop-2-en-1-ol.
| Compound Name | (1R)-1-[(2R)-1-oxo-2-[(E)-prop-1-enyl]-1,3-dithian-2-yl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 102060185 |
| Molecular Formula | C10H16O2S2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | (1R)-1-[(2R)-1-oxo-2-[(E)-prop-1-enyl]-1,3-dithian-2-yl]prop-2-en-1-ol |
| SMILES | C=C[C@@H](O)[C@]1(/C=C/C)SCCCS1=O |
| InChI | InChI=1S/C10H16O2S2/c1-3-6-10(9(11)4-2)13-7-5-8-14(10)12/h3-4,6,9,11H,2,5,7-8H2,1H3/b6-3+/t9-,10-,14?/m1/s1 |
| InChIKey | WQYFFCUUNGATQQ-DTWRBPERSA-N |
| XLogP | 1.69 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|